C21H28N2O5 — CID 57236013
2-[3-[2-[(1S,2S,3S,4R)-3-[(propoxycarbonylhydrazinylidene)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenyl]acetic acid (PubChem CID 57236013) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is 2-[3-[2-[(1S,2S,3S,4R)-3-[(propoxycarbonylhydrazinylidene)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenyl]acetic acid.
| Compound Name | 2-[3-[2-[(1S,2S,3S,4R)-3-[(propoxycarbonylhydrazinylidene)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 57236013 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 2-[3-[2-[(1S,2S,3S,4R)-3-[(propoxycarbonylhydrazinylidene)methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]phenyl]acetic acid |
| SMILES | CCCOC(=O)NN=C[C@@H]1[C@H](CCc2cccc(CC(=O)O)c2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C21H28N2O5/c1-2-10-27-21(26)23-22-13-17-16(18-8-9-19(17)28-18)7-6-14-4-3-5-15(11-14)12-20(24)25/h3-5,11,13,16-19H,2,6-10,12H2,1H3,(H,23,26)(H,24,25)/t16-,17+,18-,19+/m0/s1 |
| InChIKey | BTMMHVUJDNXJSO-ZSYWTGECSA-N |
| XLogP | 3.16 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|