C15H16N2O4S2 — CID 57241133
3-(4-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-oxo-4-sulfanylbutanoic acid (PubChem CID 57241133) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 3-(4-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-oxo-4-sulfanylbutanoic acid.
| Compound Name | 3-(4-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-oxo-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 57241133 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 3-(4-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-oxo-4-sulfanylbutanoic acid |
| SMILES | O=C(O)CC(C(=O)S)c1nc2c(N3CCOCC3)cccc2s1 |
| InChI | InChI=1S/C15H16N2O4S2/c18-12(19)8-9(15(20)22)14-16-13-10(2-1-3-11(13)23-14)17-4-6-21-7-5-17/h1-3,9H,4-8H2,(H,18,19)(H,20,22) |
| InChIKey | PCGKWDLQXGYXDA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|