C10H17BrNO3S+ — CID 57245058
(1R,2R,4S)-4-bromo-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57245058) has the molecular formula C10H17BrNO3S+ and a molecular weight of 311.22 g/mol. Its IUPAC name is (1R,2R,4S)-4-bromo-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4S)-4-bromo-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57245058 |
| Molecular Formula | C10H17BrNO3S+ |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | (1R,2R,4S)-4-bromo-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(CS)C(=O)[N@@+]1(C(=O)O)C[C@@H](Br)C[C@H]1C |
| InChI | InChI=1S/C10H16BrNO3S/c1-6(5-16)9(13)12(10(14)15)4-8(11)3-7(12)2/h6-8H,3-5H2,1-2H3,(H-,14,15,16)/p+1/t6?,7-,8+,12-/m1/s1 |
| InChIKey | XHUCQRDSDCPIKL-IPQYHECASA-O |
| XLogP | 2.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|