C11H20NO4S+ — CID 57076285
(1R,2R,4R)-4-methoxy-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57076285) has the molecular formula C11H20NO4S+ and a molecular weight of 262.35 g/mol. Its IUPAC name is (1R,2R,4R)-4-methoxy-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-4-methoxy-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57076285 |
| Molecular Formula | C11H20NO4S+ |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (1R,2R,4R)-4-methoxy-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CO[C@@H]1C[C@@H](C)[N@@+](C(=O)O)(C(=O)C(C)CS)C1 |
| InChI | InChI=1S/C11H19NO4S/c1-7(6-17)10(13)12(11(14)15)5-9(16-3)4-8(12)2/h7-9H,4-6H2,1-3H3,(H-,14,15,17)/p+1/t7?,8-,9-,12-/m1/s1 |
| InChIKey | SHYMVWBCEVECDC-ZRPURHHZSA-O |
| XLogP | 1.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|