C11H17ClN2O2S — CID 57246919
2-amino-5-chloro-N,N-diethyl-4-methylbenzenesulfonamide (PubChem CID 57246919) has the molecular formula C11H17ClN2O2S and a molecular weight of 276.79 g/mol. Its IUPAC name is 2-amino-5-chloro-N,N-diethyl-4-methylbenzenesulfonamide.
| Compound Name | 2-amino-5-chloro-N,N-diethyl-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 57246919 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-amino-5-chloro-N,N-diethyl-4-methylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(Cl)c(C)cc1N |
| InChI | InChI=1S/C11H17ClN2O2S/c1-4-14(5-2)17(15,16)11-7-9(12)8(3)6-10(11)13/h6-7H,4-5,13H2,1-3H3 |
| InChIKey | PZKHGHCLYJIMAM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|