C15H15F3O3S — CID 57253712
ethyl 4-methylsulfanyl-3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoate (PubChem CID 57253712) has the molecular formula C15H15F3O3S and a molecular weight of 332.34 g/mol. Its IUPAC name is ethyl 4-methylsulfanyl-3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoate.
| Compound Name | ethyl 4-methylsulfanyl-3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoate |
|---|---|
| PubChem CID | 57253712 |
| Molecular Formula | C15H15F3O3S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | ethyl 4-methylsulfanyl-3-oxo-2-[[2-(trifluoromethyl)phenyl]methylidene]butanoate |
| SMILES | CCOC(=O)C(=Cc1ccccc1C(F)(F)F)C(=O)CSC |
| InChI | InChI=1S/C15H15F3O3S/c1-3-21-14(20)11(13(19)9-22-2)8-10-6-4-5-7-12(10)15(16,17)18/h4-8H,3,9H2,1-2H3 |
| InChIKey | CTLXEGINCNDUFG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|