About 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate
3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate (PubChem CID 57253792) has the molecular formula C25H48O8
and a molecular weight of 476.65 g/mol. Its IUPAC name is 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate.
Molecular Properties
| Compound Name | 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate |
| PubChem CID | 57253792 |
| Molecular Formula | C25H48O8 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate |
| SMILES | CCCCOCCC(O)C(C(=O)OCCCOCCC)(C(OC)C(C)O)C1(O)CCCCC1 |
| InChI | InChI=1S/C25H48O8/c1-5-7-16-32-19-12-21(27)25(22(30-4)20(3)26,24(29)13-9-8-10-14-24)23(28)33-18-11-17-31-15-6-2/h20-22,26-27,29H,5-19H2,1-4H3 |
| InChIKey | NFNJOKLYCULGFU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate?
The IUPAC name of 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate (CID 57253792) is 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate.
What is the SMILES notation for 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate?
The canonical SMILES for 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate is CCCCOCCC(O)C(C(=O)OCCCOCCC)(C(OC)C(C)O)C1(O)CCCCC1.
What is the InChIKey of 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate?
The InChIKey is NFNJOKLYCULGFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H48O8/c1-5-7-16-32-19-12-21(27)25(22(30-4)20(3)26,24(29)13-9-8-10-14-24)23(28)33-18-11-17-31-15-6-2/h20-22,26-27,29H,5-19H2,1-4H3.
What are the key properties of 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate?
3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate has a molecular weight of 476.65 g/mol, XLogP of 2.99, 18 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxypropyl 2-(3-butoxy-1-hydroxypropyl)-4-hydroxy-2-(1-hydroxycyclohexyl)-3-methoxypentanoate is sourced from PubChem (CID 57253792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).