C32H38F3O9S2+ — CID 57254418
[(4-methylphenyl)-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium (PubChem CID 57254418) has the molecular formula C32H38F3O9S2+ and a molecular weight of 687.77 g/mol. Its IUPAC name is [(4-methylphenyl)-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium.
| Compound Name | [(4-methylphenyl)-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
|---|---|
| PubChem CID | 57254418 |
| Molecular Formula | C32H38F3O9S2+ |
| Molecular Weight | 687.77 g/mol |
| Exact Mass | 687.19 |
| IUPAC Name | [(4-methylphenyl)-bis[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-λ4-sulfanyl]-(trifluoromethylsulfonyl)oxidanium |
| SMILES | Cc1ccc(S([OH+]S(=O)(=O)C(F)(F)F)(c2ccc(OCC(=O)OC(C)(C)C)cc2)c2ccc(OCC(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C32H37F3O9S2/c1-22-8-14-25(15-9-22)45(44-46(38,39)32(33,34)35,26-16-10-23(11-17-26)40-20-28(36)42-30(2,3)4)27-18-12-24(13-19-27)41-21-29(37)43-31(5,6)7/h8-19H,20-21H2,1-7H3/p+1 |
| InChIKey | FIKWEKWQSDEDRP-UHFFFAOYSA-O |
| XLogP | 7.58 |
| TPSA | 118.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.77 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|