methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate

C18H28O8 — CID 57256972

IUPACmethyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate
SMILESCOC(=O)CCCC(CC(OC(C)=O)C1OCCCC1C=O)OC(C)=O
InChIInChI=1S/C18H28O8/c1-12(20)25-15(7-4-8-17(22)23-3)10-16(26-13(2)21)18-14(11-19)6-5-9-24-18/h11,14-16,18H,4-10H2,1-3H3
InChIKeyOMRNJCMOZQUXSV-UHFFFAOYSA-N
MW372.41 g/mol
LogP1.58
Rot. Bonds10

About methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate

methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate (PubChem CID 57256972) has the molecular formula C18H28O8 and a molecular weight of 372.41 g/mol. Its IUPAC name is methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate.

Molecular Properties

Compound Namemethyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate
PubChem CID57256972
Molecular FormulaC18H28O8
Molecular Weight372.41 g/mol
Exact Mass372.18
IUPAC Namemethyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate
SMILESCOC(=O)CCCC(CC(OC(C)=O)C1OCCCC1C=O)OC(C)=O
InChIInChI=1S/C18H28O8/c1-12(20)25-15(7-4-8-17(22)23-3)10-16(26-13(2)21)18-14(11-19)6-5-9-24-18/h11,14-16,18H,4-10H2,1-3H3
InChIKeyOMRNJCMOZQUXSV-UHFFFAOYSA-N
XLogP1.58
TPSA105.20 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds10
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500372.41
LogP ≤ 51.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate?
The IUPAC name of methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate (CID 57256972) is methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate.
What is the SMILES notation for methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate?
The canonical SMILES for methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate is COC(=O)CCCC(CC(OC(C)=O)C1OCCCC1C=O)OC(C)=O.
What is the InChIKey of methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate?
The InChIKey is OMRNJCMOZQUXSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O8/c1-12(20)25-15(7-4-8-17(22)23-3)10-16(26-13(2)21)18-14(11-19)6-5-9-24-18/h11,14-16,18H,4-10H2,1-3H3.
What are the key properties of methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate?
methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate has a molecular weight of 372.41 g/mol, XLogP of 1.58, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,7-diacetyloxy-7-(3-formyloxan-2-yl)heptanoate is sourced from PubChem (CID 57256972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).