C12H15O6PS — CID 57259642
[1,3-benzodioxol-5-ylmethoxy(hydroxy)phosphinothioyl] butanoate (PubChem CID 57259642) has the molecular formula C12H15O6PS and a molecular weight of 318.29 g/mol. Its IUPAC name is [1,3-benzodioxol-5-ylmethoxy(hydroxy)phosphinothioyl] butanoate.
| Compound Name | [1,3-benzodioxol-5-ylmethoxy(hydroxy)phosphinothioyl] butanoate |
|---|---|
| PubChem CID | 57259642 |
| Molecular Formula | C12H15O6PS |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | [1,3-benzodioxol-5-ylmethoxy(hydroxy)phosphinothioyl] butanoate |
| SMILES | CCCC(=O)OP(O)(=S)OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H15O6PS/c1-2-3-12(13)18-19(14,20)17-7-9-4-5-10-11(6-9)16-8-15-10/h4-6H,2-3,7-8H2,1H3,(H,14,20) |
| InChIKey | XRXOIZGMENWDRA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|