C21H32FIO6 — CID 57260937
(2R,3aR,4S,5R,6aS)-2-[(1R)-4-carboxy-1-iodobutyl]-4-[(3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid (PubChem CID 57260937) has the molecular formula C21H32FIO6 and a molecular weight of 526.38 g/mol. Its IUPAC name is (2R,3aR,4S,5R,6aS)-2-[(1R)-4-carboxy-1-iodobutyl]-4-[(3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid.
| Compound Name | (2R,3aR,4S,5R,6aS)-2-[(1R)-4-carboxy-1-iodobutyl]-4-[(3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid |
|---|---|
| PubChem CID | 57260937 |
| Molecular Formula | C21H32FIO6 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | (2R,3aR,4S,5R,6aS)-2-[(1R)-4-carboxy-1-iodobutyl]-4-[(3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid |
| SMILES | CCCC[C@@H](F)[C@H](O)C=C[C@H]1[C@H]2C[C@H]([C@H](I)CCCC(=O)O)O[C@H]2C[C@H]1C(=O)O |
| InChI | InChI=1S/C21H32FIO6/c1-2-3-5-15(22)17(24)9-8-12-13-10-19(16(23)6-4-7-20(25)26)29-18(13)11-14(12)21(27)28/h8-9,12-19,24H,2-7,10-11H2,1H3,(H,25,26)(H,27,28)/t12-,13+,14+,15+,16+,17+,18-,19+/m0/s1 |
| InChIKey | DTVKBOIDCWCRCU-JDGMNOCOSA-N |
| XLogP | 3.98 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|