C23H36F3IO5 — CID 70591323
(5R)-5-[(2R,3aR,4S,5R,6aS)-5-(hydroxymethyl)-4-[(E,3R,4R)-3-hydroxy-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodo-2-methylpentanoic acid (PubChem CID 70591323) has the molecular formula C23H36F3IO5 and a molecular weight of 576.43 g/mol. Its IUPAC name is (5R)-5-[(2R,3aR,4S,5R,6aS)-5-(hydroxymethyl)-4-[(E,3R,4R)-3-hydroxy-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodo-2-methylpentanoic acid.
| Compound Name | (5R)-5-[(2R,3aR,4S,5R,6aS)-5-(hydroxymethyl)-4-[(E,3R,4R)-3-hydroxy-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodo-2-methylpentanoic acid |
|---|---|
| PubChem CID | 70591323 |
| Molecular Formula | C23H36F3IO5 |
| Molecular Weight | 576.43 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | (5R)-5-[(2R,3aR,4S,5R,6aS)-5-(hydroxymethyl)-4-[(E,3R,4R)-3-hydroxy-4-(trifluoromethyl)oct-1-enyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodo-2-methylpentanoic acid |
| SMILES | CCCC[C@H]([C@H](O)/C=C/[C@H]1[C@H](CO)C[C@@H]2O[C@@H]([C@H](I)CCC(C)C(=O)O)C[C@H]12)C(F)(F)F |
| InChI | InChI=1S/C23H36F3IO5/c1-3-4-5-17(23(24,25)26)19(29)9-7-15-14(12-28)10-20-16(15)11-21(32-20)18(27)8-6-13(2)22(30)31/h7,9,13-21,28-29H,3-6,8,10-12H2,1-2H3,(H,30,31)/b9-7+/t13?,14-,15-,16+,17+,18+,19+,20-,21+/m0/s1 |
| InChIKey | MQANNJJMFVTTRV-CVFQZZEDSA-N |
| XLogP | 4.98 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|