C25H30N2O3 — CID 57265628
N-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-4-(5-methoxy-1H-indol-3-yl)butan-1-amine (PubChem CID 57265628) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-4-(5-methoxy-1H-indol-3-yl)butan-1-amine.
| Compound Name | N-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-4-(5-methoxy-1H-indol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 57265628 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-[2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethyl]-4-(5-methoxy-1H-indol-3-yl)butan-1-amine |
| SMILES | COc1ccc2[nH]cc(CCCCNC(CC3=CC=CCC3)C3=COC=CO3)c2c1 |
| InChI | InChI=1S/C25H30N2O3/c1-28-21-10-11-23-22(16-21)20(17-27-23)9-5-6-12-26-24(25-18-29-13-14-30-25)15-19-7-3-2-4-8-19/h2-3,7,10-11,13-14,16-18,24,26-27H,4-6,8-9,12,15H2,1H3 |
| InChIKey | SSUBTMRSZUMCDE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 55.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|