C12H15NO3 — CID 57271589
[3-benzyl-5-(hydroxymethyl)-2H-1,2-oxazol-5-yl]methanol (PubChem CID 57271589) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is [3-benzyl-5-(hydroxymethyl)-2H-1,2-oxazol-5-yl]methanol.
| Compound Name | [3-benzyl-5-(hydroxymethyl)-2H-1,2-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 57271589 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | [3-benzyl-5-(hydroxymethyl)-2H-1,2-oxazol-5-yl]methanol |
| SMILES | OCC1(CO)C=C(Cc2ccccc2)NO1 |
| InChI | InChI=1S/C12H15NO3/c14-8-12(9-15)7-11(13-16-12)6-10-4-2-1-3-5-10/h1-5,7,13-15H,6,8-9H2 |
| InChIKey | FONJZQCORMFTNF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |