C22H23Cl2N3O — CID 57283119
5-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-phenyl-2H-1,3,4-oxadiazole (PubChem CID 57283119) has the molecular formula C22H23Cl2N3O and a molecular weight of 416.35 g/mol. Its IUPAC name is 5-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-phenyl-2H-1,3,4-oxadiazole.
| Compound Name | 5-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-phenyl-2H-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 57283119 |
| Molecular Formula | C22H23Cl2N3O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 5-[(1R,2R,3S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]-3-phenyl-2H-1,3,4-oxadiazole |
| SMILES | CN1C2CC[C@@H]1[C@H](C1=NN(c3ccccc3)CO1)[C@@H](c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C22H23Cl2N3O/c1-26-16-8-10-20(26)21(17(12-16)14-7-9-18(23)19(24)11-14)22-25-27(13-28-22)15-5-3-2-4-6-15/h2-7,9,11,16-17,20-21H,8,10,12-13H2,1H3/t16?,17-,20-,21-/m1/s1 |
| InChIKey | WNDVPEAZYFEVGB-HCKVJRNASA-N |
| XLogP | 5.37 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |