C21H22Cl2N2O — CID 140975788
N-[[2-[(1R,2S,3S,5S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]phenyl]methylidene]hydroxylamine (PubChem CID 140975788) has the molecular formula C21H22Cl2N2O and a molecular weight of 389.33 g/mol. Its IUPAC name is N-[[2-[(1R,2S,3S,5S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]phenyl]methylidene]hydroxylamine.
| Compound Name | N-[[2-[(1R,2S,3S,5S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]phenyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 140975788 |
| Molecular Formula | C21H22Cl2N2O |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[[2-[(1R,2S,3S,5S)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]phenyl]methylidene]hydroxylamine |
| SMILES | CN1[C@H]2CC[C@@H]1[C@H](c1ccccc1C=NO)[C@@H](c1ccc(Cl)c(Cl)c1)C2 |
| InChI | InChI=1S/C21H22Cl2N2O/c1-25-15-7-9-20(25)21(16-5-3-2-4-14(16)12-24-26)17(11-15)13-6-8-18(22)19(23)10-13/h2-6,8,10,12,15,17,20-21,26H,7,9,11H2,1H3/t15-,17+,20+,21+/m0/s1 |
| InChIKey | NKVOVUNBLIGDKU-AXNOTKAXSA-N |
| XLogP | 5.54 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|