C36H70O4Si2 — CID 57283765
methyl 7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]heptanoate (PubChem CID 57283765) has the molecular formula C36H70O4Si2 and a molecular weight of 623.12 g/mol. Its IUPAC name is methyl 7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]heptanoate.
| Compound Name | methyl 7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]heptanoate |
|---|---|
| PubChem CID | 57283765 |
| Molecular Formula | C36H70O4Si2 |
| Molecular Weight | 623.12 g/mol |
| Exact Mass | 622.48 |
| IUPAC Name | methyl 7-[(4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]heptanoate |
| SMILES | CCCC[C@@H](C)C[C@@H](C=C[C@@H]1C(CCCCCCC(=O)OC)=C(C)C[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H70O4Si2/c1-15-16-21-28(2)26-30(39-41(11,12)35(4,5)6)24-25-32-31(22-19-17-18-20-23-34(37)38-10)29(3)27-33(32)40-42(13,14)36(7,8)9/h24-25,28,30,32-33H,15-23,26-27H2,1-14H3/t28-,30-,32-,33-/m1/s1 |
| InChIKey | KCISREYLXXFEFK-FNXZSKMFSA-N |
| XLogP | 11.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.12 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|