C16H16N10O — CID 57284338
2-azido-4-[(1R)-1-(diaminomethylideneamino)ethyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide (PubChem CID 57284338) has the molecular formula C16H16N10O and a molecular weight of 364.37 g/mol. Its IUPAC name is 2-azido-4-[(1R)-1-(diaminomethylideneamino)ethyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide.
| Compound Name | 2-azido-4-[(1R)-1-(diaminomethylideneamino)ethyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide |
|---|---|
| PubChem CID | 57284338 |
| Molecular Formula | C16H16N10O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-azido-4-[(1R)-1-(diaminomethylideneamino)ethyl]-N-(1H-pyrazolo[3,4-b]pyridin-4-yl)benzamide |
| SMILES | C[C@@H](N=C(N)N)c1ccc(C(=O)Nc2ccnc3[nH]ncc23)c(N=[N+]=[N-])c1 |
| InChI | InChI=1S/C16H16N10O/c1-8(22-16(17)18)9-2-3-10(13(6-9)24-26-19)15(27)23-12-4-5-20-14-11(12)7-21-25-14/h2-8H,1H3,(H4,17,18,22)(H2,20,21,23,25,27)/t8-/m1/s1 |
| InChIKey | JJIWAHVFRQHVDS-MRVPVSSYSA-N |
| XLogP | 2.49 |
| TPSA | 183.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|