C10H15N3O5S2 — CID 57286474
carbamoyl 5-hexylsulfonyl-1,3,4-thiadiazole-2-carboxylate (PubChem CID 57286474) has the molecular formula C10H15N3O5S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is carbamoyl 5-hexylsulfonyl-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | carbamoyl 5-hexylsulfonyl-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 57286474 |
| Molecular Formula | C10H15N3O5S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | carbamoyl 5-hexylsulfonyl-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCCCCCS(=O)(=O)c1nnc(C(=O)OC(N)=O)s1 |
| InChI | InChI=1S/C10H15N3O5S2/c1-2-3-4-5-6-20(16,17)10-13-12-7(19-10)8(14)18-9(11)15/h2-6H2,1H3,(H2,11,15) |
| InChIKey | MKWCGOXEJCJHEB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|