C14H19N3O4S2 — CID 67870524
6-acetyl-2-heptylsulfonyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 67870524) has the molecular formula C14H19N3O4S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 6-acetyl-2-heptylsulfonyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-acetyl-2-heptylsulfonyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 67870524 |
| Molecular Formula | C14H19N3O4S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 6-acetyl-2-heptylsulfonyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | CCCCCCCS(=O)(=O)c1nn2cc(C(C)=O)c(=O)nc2s1 |
| InChI | InChI=1S/C14H19N3O4S2/c1-3-4-5-6-7-8-23(20,21)14-16-17-9-11(10(2)18)12(19)15-13(17)22-14/h9H,3-8H2,1-2H3 |
| InChIKey | KYLOPMRNOOKLIT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|