C19H18F3NO7 — CID 57292130
methyl (3S,5S)-3,5-dihydroxy-7-[5-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-yl]hept-6-enoate (PubChem CID 57292130) has the molecular formula C19H18F3NO7 and a molecular weight of 429.35 g/mol. Its IUPAC name is methyl (3S,5S)-3,5-dihydroxy-7-[5-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-yl]hept-6-enoate.
| Compound Name | methyl (3S,5S)-3,5-dihydroxy-7-[5-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-yl]hept-6-enoate |
|---|---|
| PubChem CID | 57292130 |
| Molecular Formula | C19H18F3NO7 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | methyl (3S,5S)-3,5-dihydroxy-7-[5-[2-nitro-4-(trifluoromethyl)phenyl]furan-2-yl]hept-6-enoate |
| SMILES | COC(=O)C[C@@H](O)C[C@H](O)C=Cc1ccc(-c2ccc(C(F)(F)F)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C19H18F3NO7/c1-29-18(26)10-13(25)9-12(24)3-4-14-5-7-17(30-14)15-6-2-11(19(20,21)22)8-16(15)23(27)28/h2-8,12-13,24-25H,9-10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | VEHFWVSWSCGXIK-OLZOCXBDSA-N |
| XLogP | 3.56 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|