C20H31NO3 — CID 57294686
4-[[(2S,3aR,6R,6aS)-6a-hydroxy-6-(3-oxooct-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy]butanenitrile (PubChem CID 57294686) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is 4-[[(2S,3aR,6R,6aS)-6a-hydroxy-6-(3-oxooct-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy]butanenitrile.
| Compound Name | 4-[[(2S,3aR,6R,6aS)-6a-hydroxy-6-(3-oxooct-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy]butanenitrile |
|---|---|
| PubChem CID | 57294686 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 4-[[(2S,3aR,6R,6aS)-6a-hydroxy-6-(3-oxooct-1-enyl)-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy]butanenitrile |
| SMILES | CCCCCC(=O)C=C[C@H]1CC[C@@H]2C[C@H](OCCCC#N)C[C@]21O |
| InChI | InChI=1S/C20H31NO3/c1-2-3-4-7-18(22)11-10-16-8-9-17-14-19(15-20(16,17)23)24-13-6-5-12-21/h10-11,16-17,19,23H,2-9,13-15H2,1H3/t16-,17-,19+,20-/m1/s1 |
| InChIKey | NYMROANRTRKHAK-IZBJGVDFSA-N |
| XLogP | 3.93 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|