C28H39NO5Si — CID 57297187
ethyl (3R,4S)-2-oxo-4-(4-phenylmethoxyphenyl)-3-tri(propan-2-yl)silyloxyazetidine-1-carboxylate (PubChem CID 57297187) has the molecular formula C28H39NO5Si and a molecular weight of 497.71 g/mol. Its IUPAC name is ethyl (3R,4S)-2-oxo-4-(4-phenylmethoxyphenyl)-3-tri(propan-2-yl)silyloxyazetidine-1-carboxylate.
| Compound Name | ethyl (3R,4S)-2-oxo-4-(4-phenylmethoxyphenyl)-3-tri(propan-2-yl)silyloxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 57297187 |
| Molecular Formula | C28H39NO5Si |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | ethyl (3R,4S)-2-oxo-4-(4-phenylmethoxyphenyl)-3-tri(propan-2-yl)silyloxyazetidine-1-carboxylate |
| SMILES | CCOC(=O)N1C(=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H39NO5Si/c1-8-32-28(31)29-25(26(27(29)30)34-35(19(2)3,20(4)5)21(6)7)23-14-16-24(17-15-23)33-18-22-12-10-9-11-13-22/h9-17,19-21,25-26H,8,18H2,1-7H3/t25-,26+/m0/s1 |
| InChIKey | GXFGRRQTIRRSOU-IZZNHLLZSA-N |
| XLogP | 6.87 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|