About CID 57302108
CID 57302108 (PubChem CID 57302108) has the molecular formula C14H10BO4
and a molecular weight of 253.04 g/mol.
Molecular Properties
| Compound Name | CID 57302108 |
| PubChem CID | 57302108 |
| Molecular Formula | C14H10BO4 |
| Molecular Weight | 253.04 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | — |
| SMILES | O=Cc1ccc(O[B]Oc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C14H10BO4/c16-9-11-1-5-13(6-2-11)18-15-19-14-7-3-12(10-17)4-8-14/h1-10H |
| InChIKey | CQJUTDKHTRYHHU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.04 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57302108 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57302108?
The IUPAC name of CID 57302108 (CID 57302108) is not available.
What is the SMILES notation for CID 57302108?
The canonical SMILES for CID 57302108 is O=Cc1ccc(O[B]Oc2ccc(C=O)cc2)cc1.
What is the InChIKey of CID 57302108?
The InChIKey is CQJUTDKHTRYHHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BO4/c16-9-11-1-5-13(6-2-11)18-15-19-14-7-3-12(10-17)4-8-14/h1-10H.
What are the key properties of CID 57302108?
CID 57302108 has a molecular weight of 253.04 g/mol, XLogP of 2.30, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57302108 is sourced from PubChem (CID 57302108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).