C8H22N4O3P+ — CID 57302111
bis(1,2-diaminobutoxy)-oxophosphanium (PubChem CID 57302111) has the molecular formula C8H22N4O3P+ and a molecular weight of 253.26 g/mol. Its IUPAC name is bis(1,2-diaminobutoxy)-oxophosphanium.
| Compound Name | bis(1,2-diaminobutoxy)-oxophosphanium |
|---|---|
| PubChem CID | 57302111 |
| Molecular Formula | C8H22N4O3P+ |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | bis(1,2-diaminobutoxy)-oxophosphanium |
| SMILES | CCC(N)C(N)O[P+](=O)OC(N)C(N)CC |
| InChI | InChI=1S/C8H22N4O3P/c1-3-5(9)7(11)14-16(13)15-8(12)6(10)4-2/h5-8H,3-4,9-12H2,1-2H3/q+1 |
| InChIKey | AKEBAPVZEHFVOV-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|