About 7-bromo-3,8-dimethyl-6-oxononanal
7-bromo-3,8-dimethyl-6-oxononanal (PubChem CID 57321141) has the molecular formula C11H19BrO2
and a molecular weight of 263.17 g/mol. Its IUPAC name is 7-bromo-3,8-dimethyl-6-oxononanal.
Molecular Properties
| Compound Name | 7-bromo-3,8-dimethyl-6-oxononanal |
| PubChem CID | 57321141 |
| Molecular Formula | C11H19BrO2 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 7-bromo-3,8-dimethyl-6-oxononanal |
| SMILES | CC(CC=O)CCC(=O)C(Br)C(C)C |
| InChI | InChI=1S/C11H19BrO2/c1-8(2)11(12)10(14)5-4-9(3)6-7-13/h7-9,11H,4-6H2,1-3H3 |
| InChIKey | JLNFBLIACPUIRW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-3,8-dimethyl-6-oxononanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3,8-dimethyl-6-oxononanal?
The IUPAC name of 7-bromo-3,8-dimethyl-6-oxononanal (CID 57321141) is 7-bromo-3,8-dimethyl-6-oxononanal.
What is the SMILES notation for 7-bromo-3,8-dimethyl-6-oxononanal?
The canonical SMILES for 7-bromo-3,8-dimethyl-6-oxononanal is CC(CC=O)CCC(=O)C(Br)C(C)C.
What is the InChIKey of 7-bromo-3,8-dimethyl-6-oxononanal?
The InChIKey is JLNFBLIACPUIRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BrO2/c1-8(2)11(12)10(14)5-4-9(3)6-7-13/h7-9,11H,4-6H2,1-3H3.
What are the key properties of 7-bromo-3,8-dimethyl-6-oxononanal?
7-bromo-3,8-dimethyl-6-oxononanal has a molecular weight of 263.17 g/mol, XLogP of 2.98, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3,8-dimethyl-6-oxononanal is sourced from PubChem (CID 57321141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).