C17H20N2O6S — CID 57324807
(2R,3S)-2-(2-methylpropyl)-3-(quinolin-2-ylsulfonylamino)butanedioic acid (PubChem CID 57324807) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is (2R,3S)-2-(2-methylpropyl)-3-(quinolin-2-ylsulfonylamino)butanedioic acid.
| Compound Name | (2R,3S)-2-(2-methylpropyl)-3-(quinolin-2-ylsulfonylamino)butanedioic acid |
|---|---|
| PubChem CID | 57324807 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (2R,3S)-2-(2-methylpropyl)-3-(quinolin-2-ylsulfonylamino)butanedioic acid |
| SMILES | CC(C)C[C@@H](C(=O)O)[C@H](NS(=O)(=O)c1ccc2ccccc2n1)C(=O)O |
| InChI | InChI=1S/C17H20N2O6S/c1-10(2)9-12(16(20)21)15(17(22)23)19-26(24,25)14-8-7-11-5-3-4-6-13(11)18-14/h3-8,10,12,15,19H,9H2,1-2H3,(H,20,21)(H,22,23)/t12-,15+/m1/s1 |
| InChIKey | YWEOYSRSYXLIEH-DOMZBBRYSA-N |
| XLogP | 1.71 |
| TPSA | 133.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |