C26H38ClN3O2 — CID 57333383
3-decyl-1-hexylbenzo[f]benzotriazol-3-ium-4,9-dione chloride (PubChem CID 57333383) has the molecular formula C26H38ClN3O2 and a molecular weight of 460.06 g/mol. Its IUPAC name is 3-decyl-1-hexylbenzo[f]benzotriazol-3-ium-4,9-dione chloride.
| Compound Name | 3-decyl-1-hexylbenzo[f]benzotriazol-3-ium-4,9-dione chloride |
|---|---|
| PubChem CID | 57333383 |
| Molecular Formula | C26H38ClN3O2 |
| Molecular Weight | 460.06 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 3-decyl-1-hexylbenzo[f]benzotriazol-3-ium-4,9-dione chloride |
| SMILES | CCCCCCCCCC[n+]1nn(CCCCCC)c2c1C(=O)c1ccccc1C2=O.[Cl-] |
| InChI | InChI=1S/C26H38N3O2.ClH/c1-3-5-7-9-10-11-12-16-20-29-24-23(28(27-29)19-15-8-6-4-2)25(30)21-17-13-14-18-22(21)26(24)31;/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | JMVNPZXGCKSZOW-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.06 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|