C18H21N2O2+ — CID 155514001
3-butyl-1-ethyl-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione (PubChem CID 155514001) has the molecular formula C18H21N2O2+ and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-butyl-1-ethyl-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione.
| Compound Name | 3-butyl-1-ethyl-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione |
|---|---|
| PubChem CID | 155514001 |
| Molecular Formula | C18H21N2O2+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 3-butyl-1-ethyl-2-methylbenzo[f]benzimidazol-3-ium-4,9-dione |
| SMILES | CCCC[n+]1c2c(n(CC)c1C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C18H21N2O2/c1-4-6-11-20-12(3)19(5-2)15-16(20)18(22)14-10-8-7-9-13(14)17(15)21/h7-10H,4-6,11H2,1-3H3/q+1 |
| InChIKey | KYBSCVPDWJYQMA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|