C20H25N2O2+ — CID 155528283
1-butyl-2-methyl-3-(2-methylpropyl)benzo[f]benzimidazol-3-ium-4,9-dione (PubChem CID 155528283) has the molecular formula C20H25N2O2+ and a molecular weight of 325.43 g/mol. Its IUPAC name is 1-butyl-2-methyl-3-(2-methylpropyl)benzo[f]benzimidazol-3-ium-4,9-dione.
| Compound Name | 1-butyl-2-methyl-3-(2-methylpropyl)benzo[f]benzimidazol-3-ium-4,9-dione |
|---|---|
| PubChem CID | 155528283 |
| Molecular Formula | C20H25N2O2+ |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-butyl-2-methyl-3-(2-methylpropyl)benzo[f]benzimidazol-3-ium-4,9-dione |
| SMILES | CCCCn1c2c([n+](CC(C)C)c1C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H25N2O2/c1-5-6-11-21-14(4)22(12-13(2)3)18-17(21)19(23)15-9-7-8-10-16(15)20(18)24/h7-10,13H,5-6,11-12H2,1-4H3/q+1 |
| InChIKey | RXFVYIBRTVBHPE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|