C20H26O5 — CID 57338561
ethyl (2R,3R,5S,6R)-6-(4-methoxycarbonylphenyl)-2-methyl-5-prop-1-en-2-yloxane-3-carboxylate (PubChem CID 57338561) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is ethyl (2R,3R,5S,6R)-6-(4-methoxycarbonylphenyl)-2-methyl-5-prop-1-en-2-yloxane-3-carboxylate.
| Compound Name | ethyl (2R,3R,5S,6R)-6-(4-methoxycarbonylphenyl)-2-methyl-5-prop-1-en-2-yloxane-3-carboxylate |
|---|---|
| PubChem CID | 57338561 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | ethyl (2R,3R,5S,6R)-6-(4-methoxycarbonylphenyl)-2-methyl-5-prop-1-en-2-yloxane-3-carboxylate |
| SMILES | C=C(C)[C@@H]1C[C@@H](C(=O)OCC)[C@@H](C)O[C@H]1c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C20H26O5/c1-6-24-20(22)17-11-16(12(2)3)18(25-13(17)4)14-7-9-15(10-8-14)19(21)23-5/h7-10,13,16-18H,2,6,11H2,1,3-5H3/t13-,16+,17-,18+/m1/s1 |
| InChIKey | LEWDCIPMKBRLPA-RNJTYBCJSA-N |
| XLogP | 3.69 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|