C8H14O6 — CID 57345802
5,6,7,8-tetrahydroxy-4-oxooctanal (PubChem CID 57345802) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroxy-4-oxooctanal.
| Compound Name | 5,6,7,8-tetrahydroxy-4-oxooctanal |
|---|---|
| PubChem CID | 57345802 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 5,6,7,8-tetrahydroxy-4-oxooctanal |
| SMILES | O=CCCC(=O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C8H14O6/c9-3-1-2-5(11)7(13)8(14)6(12)4-10/h3,6-8,10,12-14H,1-2,4H2 |
| InChIKey | XFCGLWRWUATEAY-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|