About 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride
2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride (PubChem CID 57350019) has the molecular formula C9H19ClN2O
and a molecular weight of 206.72 g/mol. Its IUPAC name is 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride.
Analyze 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride?
The IUPAC name of 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride (CID 57350019) is 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride.
What is the SMILES notation for 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride?
The canonical SMILES for 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride is CCCC[NH+]1C=CN(CCO)C1.[Cl-].
What is the InChIKey of 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride?
The InChIKey is MGZFKCKWIRPETH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.ClH/c1-2-3-4-10-5-6-11(9-10)7-8-12;/h5-6,12H,2-4,7-9H2,1H3;1H.
What are the key properties of 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride?
2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride has a molecular weight of 206.72 g/mol, XLogP of -3.59, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-butyl-1,2-dihydroimidazol-1-ium-3-yl)ethanol chloride is sourced from PubChem (CID 57350019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).