C12H20N4S2 — CID 57350859
4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide (PubChem CID 57350859) has the molecular formula C12H20N4S2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide.
| Compound Name | 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 57350859 |
| Molecular Formula | C12H20N4S2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide |
| SMILES | C=CCN(CC=C)C(=S)N1CCN(C(N)=S)CC1 |
| InChI | InChI=1S/C12H20N4S2/c1-3-5-15(6-4-2)12(18)16-9-7-14(8-10-16)11(13)17/h3-4H,1-2,5-10H2,(H2,13,17) |
| InChIKey | CLCCUMVRFDXFRZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|