About 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide
4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide (PubChem CID 57350859) has the molecular formula C12H20N4S2
and a molecular weight of 284.45 g/mol. Its IUPAC name is 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide.
Molecular Properties
| Compound Name | 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide |
| PubChem CID | 57350859 |
| Molecular Formula | C12H20N4S2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide |
| SMILES | C=CCN(CC=C)C(=S)N1CCN(C(N)=S)CC1 |
| InChI | InChI=1S/C12H20N4S2/c1-3-5-15(6-4-2)12(18)16-9-7-14(8-10-16)11(13)17/h3-4H,1-2,5-10H2,(H2,13,17) |
| InChIKey | CLCCUMVRFDXFRZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide?
The IUPAC name of 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide (CID 57350859) is 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide.
What is the SMILES notation for 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide?
The canonical SMILES for 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide is C=CCN(CC=C)C(=S)N1CCN(C(N)=S)CC1.
What is the InChIKey of 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide?
The InChIKey is CLCCUMVRFDXFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4S2/c1-3-5-15(6-4-2)12(18)16-9-7-14(8-10-16)11(13)17/h3-4H,1-2,5-10H2,(H2,13,17).
What are the key properties of 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide?
4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide has a molecular weight of 284.45 g/mol, XLogP of 0.81, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-bis(prop-2-enyl)piperazine-1,4-dicarbothioamide is sourced from PubChem (CID 57350859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).