C16H14N8O3 — CID 57354047
3-[2-[(4-azido-3-nitroanilino)diazenyl]ethyl]-1H-indol-5-ol (PubChem CID 57354047) has the molecular formula C16H14N8O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is 3-[2-[(4-azido-3-nitroanilino)diazenyl]ethyl]-1H-indol-5-ol.
| Compound Name | 3-[2-[(4-azido-3-nitroanilino)diazenyl]ethyl]-1H-indol-5-ol |
|---|---|
| PubChem CID | 57354047 |
| Molecular Formula | C16H14N8O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-[2-[(4-azido-3-nitroanilino)diazenyl]ethyl]-1H-indol-5-ol |
| SMILES | [N-]=[N+]=Nc1ccc(N/N=N/CCc2c[nH]c3ccc(O)cc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N8O3/c17-22-21-15-3-1-11(7-16(15)24(26)27)20-23-19-6-5-10-9-18-14-4-2-12(25)8-13(10)14/h1-4,7-9,18,25H,5-6H2,(H,19,20) |
| InChIKey | ZQHHIGSJKPKZTA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 164.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|