C19H16N4O3S — CID 87929680
3-[2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]ethyl]-1H-indol-5-ol (PubChem CID 87929680) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 3-[2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]ethyl]-1H-indol-5-ol.
| Compound Name | 3-[2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]ethyl]-1H-indol-5-ol |
|---|---|
| PubChem CID | 87929680 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-[2-[[4-(4-nitrophenyl)-1,3-thiazol-2-yl]amino]ethyl]-1H-indol-5-ol |
| SMILES | O=[N+]([O-])c1ccc(-c2csc(NCCc3c[nH]c4ccc(O)cc34)n2)cc1 |
| InChI | InChI=1S/C19H16N4O3S/c24-15-5-6-17-16(9-15)13(10-21-17)7-8-20-19-22-18(11-27-19)12-1-3-14(4-2-12)23(25)26/h1-6,9-11,21,24H,7-8H2,(H,20,22) |
| InChIKey | WETKFMDVXAJOFP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|