C17H12F3N3O2S — CID 154801498
N-[2-(2,4-difluorophenyl)ethyl]-4-(2-fluoro-4-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 154801498) has the molecular formula C17H12F3N3O2S and a molecular weight of 379.36 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)ethyl]-4-(2-fluoro-4-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[2-(2,4-difluorophenyl)ethyl]-4-(2-fluoro-4-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 154801498 |
| Molecular Formula | C17H12F3N3O2S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)ethyl]-4-(2-fluoro-4-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2csc(NCCc3ccc(F)cc3F)n2)c(F)c1 |
| InChI | InChI=1S/C17H12F3N3O2S/c18-11-2-1-10(14(19)7-11)5-6-21-17-22-16(9-26-17)13-4-3-12(23(24)25)8-15(13)20/h1-4,7-9H,5-6H2,(H,21,22) |
| InChIKey | OTCNNPDSTFAWCF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|