C38H26Cl3N5O4 — CID 57354759
N-(4-benzamidophenyl)-4-[[2-methyl-5-[(2,4,5-trichlorophenyl)carbamoyl]phenyl]hydrazinylidene]-3-oxonaphthalene-2-carboxamide (PubChem CID 57354759) has the molecular formula C38H26Cl3N5O4 and a molecular weight of 723.02 g/mol. Its IUPAC name is N-(4-benzamidophenyl)-4-[[2-methyl-5-[(2,4,5-trichlorophenyl)carbamoyl]phenyl]hydrazinylidene]-3-oxonaphthalene-2-carboxamide.
| Compound Name | N-(4-benzamidophenyl)-4-[[2-methyl-5-[(2,4,5-trichlorophenyl)carbamoyl]phenyl]hydrazinylidene]-3-oxonaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 57354759 |
| Molecular Formula | C38H26Cl3N5O4 |
| Molecular Weight | 723.02 g/mol |
| Exact Mass | 721.11 |
| IUPAC Name | N-(4-benzamidophenyl)-4-[[2-methyl-5-[(2,4,5-trichlorophenyl)carbamoyl]phenyl]hydrazinylidene]-3-oxonaphthalene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1NN=C1C(=O)C(C(=O)Nc2ccc(NC(=O)c3ccccc3)cc2)=Cc2ccccc21 |
| InChI | InChI=1S/C38H26Cl3N5O4/c1-21-11-12-24(37(49)44-33-20-30(40)29(39)19-31(33)41)18-32(21)45-46-34-27-10-6-5-9-23(27)17-28(35(34)47)38(50)43-26-15-13-25(14-16-26)42-36(48)22-7-3-2-4-8-22/h2-20,45H,1H3,(H,42,48)(H,43,50)(H,44,49) |
| InChIKey | NGGUUCWCSXSBMZ-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.02 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|