C24H17N3Na2O6S2 — CID 57354773
disodium;6-amino-5-[[4-(2-phenylethenyl)-3-sulfonatophenyl]diazenyl]naphthalene-2-sulfonate (PubChem CID 57354773) has the molecular formula C24H17N3Na2O6S2 and a molecular weight of 553.53 g/mol. Its IUPAC name is disodium;6-amino-5-[[4-(2-phenylethenyl)-3-sulfonatophenyl]diazenyl]naphthalene-2-sulfonate.
| Compound Name | disodium;6-amino-5-[[4-(2-phenylethenyl)-3-sulfonatophenyl]diazenyl]naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 57354773 |
| Molecular Formula | C24H17N3Na2O6S2 |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | disodium;6-amino-5-[[4-(2-phenylethenyl)-3-sulfonatophenyl]diazenyl]naphthalene-2-sulfonate |
| SMILES | Nc1ccc2cc(S(=O)(=O)[O-])ccc2c1/N=N/c1ccc(C=Cc2ccccc2)c(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C24H19N3O6S2.2Na/c25-22-13-9-18-14-20(34(28,29)30)11-12-21(18)24(22)27-26-19-10-8-17(23(15-19)35(31,32)33)7-6-16-4-2-1-3-5-16;;/h1-15H,25H2,(H,28,29,30)(H,31,32,33);;/q;2*+1/p-2/b7-6?,27-26+;; |
| InChIKey | NKGTZKMQFBLVBM-ZCKNGVGTSA-L |
| XLogP | -1.18 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|