C18H23NO2S — CID 57360706
2-(3-ethoxy-1-hydroxy-2-phenylsulfanylprop-2-enyl)-4,4-dimethylpent-2-enenitrile (PubChem CID 57360706) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is 2-(3-ethoxy-1-hydroxy-2-phenylsulfanylprop-2-enyl)-4,4-dimethylpent-2-enenitrile.
| Compound Name | 2-(3-ethoxy-1-hydroxy-2-phenylsulfanylprop-2-enyl)-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 57360706 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-(3-ethoxy-1-hydroxy-2-phenylsulfanylprop-2-enyl)-4,4-dimethylpent-2-enenitrile |
| SMILES | CCOC=C(Sc1ccccc1)C(O)C(C#N)=CC(C)(C)C |
| InChI | InChI=1S/C18H23NO2S/c1-5-21-13-16(22-15-9-7-6-8-10-15)17(20)14(12-19)11-18(2,3)4/h6-11,13,17,20H,5H2,1-4H3 |
| InChIKey | VCSBRBJWXGBQCJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|