C29H33N2O9S- — CID 57363430
N-[(2R)-5-[cyclopentylmethyl-(4-methoxyphenyl)sulfonylamino]-3,4,5-trioxo-1-phenylpentan-2-yl]-N-[(3S)-oxolan-3-yl]carbamate (PubChem CID 57363430) has the molecular formula C29H33N2O9S- and a molecular weight of 585.66 g/mol. Its IUPAC name is N-[(2R)-5-[cyclopentylmethyl-(4-methoxyphenyl)sulfonylamino]-3,4,5-trioxo-1-phenylpentan-2-yl]-N-[(3S)-oxolan-3-yl]carbamate.
| Compound Name | N-[(2R)-5-[cyclopentylmethyl-(4-methoxyphenyl)sulfonylamino]-3,4,5-trioxo-1-phenylpentan-2-yl]-N-[(3S)-oxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 57363430 |
| Molecular Formula | C29H33N2O9S- |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | N-[(2R)-5-[cyclopentylmethyl-(4-methoxyphenyl)sulfonylamino]-3,4,5-trioxo-1-phenylpentan-2-yl]-N-[(3S)-oxolan-3-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC2CCCC2)C(=O)C(=O)C(=O)[C@@H](Cc2ccccc2)N(C(=O)[O-])[C@H]2CCOC2)cc1 |
| InChI | InChI=1S/C29H34N2O9S/c1-39-23-11-13-24(14-12-23)41(37,38)30(18-21-9-5-6-10-21)28(34)27(33)26(32)25(17-20-7-3-2-4-8-20)31(29(35)36)22-15-16-40-19-22/h2-4,7-8,11-14,21-22,25H,5-6,9-10,15-19H2,1H3,(H,35,36)/p-1/t22-,25+/m0/s1 |
| InChIKey | UPLXBDXSJGCENM-WIOPSUGQSA-M |
| XLogP | 1.59 |
| TPSA | 150.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|