C30H35NO7 — CID 57373425
(3S)-2-acetyloxy-2-[3-(acetyloxymethyl)-2,4,4-trimethylcyclohex-2-en-1-yl]-3-benzamido-3-phenylpropanoic acid (PubChem CID 57373425) has the molecular formula C30H35NO7 and a molecular weight of 521.61 g/mol. Its IUPAC name is (3S)-2-acetyloxy-2-[3-(acetyloxymethyl)-2,4,4-trimethylcyclohex-2-en-1-yl]-3-benzamido-3-phenylpropanoic acid.
| Compound Name | (3S)-2-acetyloxy-2-[3-(acetyloxymethyl)-2,4,4-trimethylcyclohex-2-en-1-yl]-3-benzamido-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 57373425 |
| Molecular Formula | C30H35NO7 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | (3S)-2-acetyloxy-2-[3-(acetyloxymethyl)-2,4,4-trimethylcyclohex-2-en-1-yl]-3-benzamido-3-phenylpropanoic acid |
| SMILES | CC(=O)OCC1=C(C)C(C(OC(C)=O)(C(=O)O)[C@@H](NC(=O)c2ccccc2)c2ccccc2)CCC1(C)C |
| InChI | InChI=1S/C30H35NO7/c1-19-24(16-17-29(4,5)25(19)18-37-20(2)32)30(28(35)36,38-21(3)33)26(22-12-8-6-9-13-22)31-27(34)23-14-10-7-11-15-23/h6-15,24,26H,16-18H2,1-5H3,(H,31,34)(H,35,36)/t24?,26-,30?/m0/s1 |
| InChIKey | LYACFUWNLXKQKE-OUZZWEIQSA-N |
| XLogP | 4.86 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|