C13H18NO4P-2 — CID 57375139
[(3-ethyl-1-phenylpentylidene)amino] phosphate (PubChem CID 57375139) has the molecular formula C13H18NO4P-2 and a molecular weight of 283.26 g/mol. Its IUPAC name is [(3-ethyl-1-phenylpentylidene)amino] phosphate.
| Compound Name | [(3-ethyl-1-phenylpentylidene)amino] phosphate |
|---|---|
| PubChem CID | 57375139 |
| Molecular Formula | C13H18NO4P-2 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | [(3-ethyl-1-phenylpentylidene)amino] phosphate |
| SMILES | CCC(CC)CC(=NOP(=O)([O-])[O-])c1ccccc1 |
| InChI | InChI=1S/C13H20NO4P/c1-3-11(4-2)10-13(14-18-19(15,16)17)12-8-6-5-7-9-12/h5-9,11H,3-4,10H2,1-2H3,(H2,15,16,17)/p-2 |
| InChIKey | AIBJJJNYQAATGJ-UHFFFAOYSA-L |
| XLogP | 2.06 |
| TPSA | 84.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|