C9H16N4O4S — CID 57375477
2,5-diamino-5-oxopentanoic acid;1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 57375477) has the molecular formula C9H16N4O4S and a molecular weight of 276.32 g/mol. Its IUPAC name is 2,5-diamino-5-oxopentanoic acid;1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 2,5-diamino-5-oxopentanoic acid;1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 57375477 |
| Molecular Formula | C9H16N4O4S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2,5-diamino-5-oxopentanoic acid;1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CN1CC(=O)NC1=S.NC(=O)CCC(N)C(=O)O |
| InChI | InChI=1S/C5H10N2O3.C4H6N2OS/c6-3(5(9)10)1-2-4(7)8;1-6-2-3(7)5-4(6)8/h3H,1-2,6H2,(H2,7,8)(H,9,10);2H2,1H3,(H,5,7,8) |
| InChIKey | OZFSAMGPDDSFRP-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|