C17H15BrO3 — CID 57379071
2-(2-bromophenyl)-2-(1,3-dioxolan-2-yl)-1-phenylethanone (PubChem CID 57379071) has the molecular formula C17H15BrO3 and a molecular weight of 347.21 g/mol. Its IUPAC name is 2-(2-bromophenyl)-2-(1,3-dioxolan-2-yl)-1-phenylethanone.
| Compound Name | 2-(2-bromophenyl)-2-(1,3-dioxolan-2-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 57379071 |
| Molecular Formula | C17H15BrO3 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 2-(2-bromophenyl)-2-(1,3-dioxolan-2-yl)-1-phenylethanone |
| SMILES | O=C(c1ccccc1)C(c1ccccc1Br)C1OCCO1 |
| InChI | InChI=1S/C17H15BrO3/c18-14-9-5-4-8-13(14)15(17-20-10-11-21-17)16(19)12-6-2-1-3-7-12/h1-9,15,17H,10-11H2 |
| InChIKey | DNESPFWTRAYINR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |