C16H14O2 — CID 89270842
2-(oxiran-2-yl)-1,2-diphenylethanone (PubChem CID 89270842) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(oxiran-2-yl)-1,2-diphenylethanone.
| Compound Name | 2-(oxiran-2-yl)-1,2-diphenylethanone |
|---|---|
| PubChem CID | 89270842 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-(oxiran-2-yl)-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(c1ccccc1)C1CO1 |
| InChI | InChI=1S/C16H14O2/c17-16(13-9-5-2-6-10-13)15(14-11-18-14)12-7-3-1-4-8-12/h1-10,14-15H,11H2 |
| InChIKey | XYDCJPZFGRHOFY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|