C21H15Cl3N2 — CID 57380004
3-(2-phenylethyl)-1-(2,4,6-trichlorophenyl)indazole (PubChem CID 57380004) has the molecular formula C21H15Cl3N2 and a molecular weight of 401.72 g/mol. Its IUPAC name is 3-(2-phenylethyl)-1-(2,4,6-trichlorophenyl)indazole.
| Compound Name | 3-(2-phenylethyl)-1-(2,4,6-trichlorophenyl)indazole |
|---|---|
| PubChem CID | 57380004 |
| Molecular Formula | C21H15Cl3N2 |
| Molecular Weight | 401.72 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 3-(2-phenylethyl)-1-(2,4,6-trichlorophenyl)indazole |
| SMILES | Clc1cc(Cl)c(-n2nc(CCc3ccccc3)c3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C21H15Cl3N2/c22-15-12-17(23)21(18(24)13-15)26-20-9-5-4-8-16(20)19(25-26)11-10-14-6-2-1-3-7-14/h1-9,12-13H,10-11H2 |
| InChIKey | RXDOBKBGDSYBDS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.72 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |