C16H11NO4 — CID 57381338
2-hydroxy-11-methoxy-7H-chromeno[3,4-b]indol-6-one (PubChem CID 57381338) has the molecular formula C16H11NO4 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-hydroxy-11-methoxy-7H-chromeno[3,4-b]indol-6-one.
| Compound Name | 2-hydroxy-11-methoxy-7H-chromeno[3,4-b]indol-6-one |
|---|---|
| PubChem CID | 57381338 |
| Molecular Formula | C16H11NO4 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-hydroxy-11-methoxy-7H-chromeno[3,4-b]indol-6-one |
| SMILES | COc1cccc2[nH]c3c(=O)oc4ccc(O)cc4c3c12 |
| InChI | InChI=1S/C16H11NO4/c1-20-12-4-2-3-10-14(12)13-9-7-8(18)5-6-11(9)21-16(19)15(13)17-10/h2-7,17-18H,1H3 |
| InChIKey | JAODCGWWLWBPAI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|