C11H8F4N2OS — CID 57381908
4-phenyl-5-(1,1,2,2-tetrafluoroethoxy)-1,3-thiazol-2-amine (PubChem CID 57381908) has the molecular formula C11H8F4N2OS and a molecular weight of 292.26 g/mol. Its IUPAC name is 4-phenyl-5-(1,1,2,2-tetrafluoroethoxy)-1,3-thiazol-2-amine.
| Compound Name | 4-phenyl-5-(1,1,2,2-tetrafluoroethoxy)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 57381908 |
| Molecular Formula | C11H8F4N2OS |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 4-phenyl-5-(1,1,2,2-tetrafluoroethoxy)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c(OC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C11H8F4N2OS/c12-9(13)11(14,15)18-8-7(17-10(16)19-8)6-4-2-1-3-5-6/h1-5,9H,(H2,16,17) |
| InChIKey | ATPZXARIFMIMIC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|