C19H18N2O — CID 57385916
(9aS)-2,9a-dimethyl-3-phenyl-4,5-dihydrobenzo[g]indazol-7-one (PubChem CID 57385916) has the molecular formula C19H18N2O and a molecular weight of 290.37 g/mol. Its IUPAC name is (9aS)-2,9a-dimethyl-3-phenyl-4,5-dihydrobenzo[g]indazol-7-one.
| Compound Name | (9aS)-2,9a-dimethyl-3-phenyl-4,5-dihydrobenzo[g]indazol-7-one |
|---|---|
| PubChem CID | 57385916 |
| Molecular Formula | C19H18N2O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (9aS)-2,9a-dimethyl-3-phenyl-4,5-dihydrobenzo[g]indazol-7-one |
| SMILES | Cn1nc2c(c1-c1ccccc1)CCC1=CC(=O)C=C[C@@]12C |
| InChI | InChI=1S/C19H18N2O/c1-19-11-10-15(22)12-14(19)8-9-16-17(21(2)20-18(16)19)13-6-4-3-5-7-13/h3-7,10-12H,8-9H2,1-2H3/t19-/m0/s1 |
| InChIKey | HGTWHSKAWTVZTP-IBGZPJMESA-N |
| XLogP | 3.36 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |